Difference between revisions of "ILE-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...")
(Created page with "Category:metabolite == Metabolite CPD-19151 == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBAMYUL-L-ASPARTATE ==
+
== Metabolite CPD-19151 ==
 
* common-name:
 
* common-name:
** n-carbamoyl-l-aspartate
+
** (s)-3-hydroxy-(5z)-dodecenoyl-coa
 
* smiles:
 
* smiles:
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
+
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hlkxyzvtanabhz-reohclbhsa-l
+
** ayordfmyybnsbo-qccsjadrsa-j
 
* molecular-weight:
 
* molecular-weight:
** 174.113
+
** 959.791
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN-17798]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN-17797]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-carbamoyl-l-aspartate}}
+
{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
{{#set: molecular-weight=174.113}}
+
{{#set: molecular-weight=959.791}}

Revision as of 13:07, 14 January 2021

Metabolite CPD-19151

  • common-name:
    • (s)-3-hydroxy-(5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ayordfmyybnsbo-qccsjadrsa-j
  • molecular-weight:
    • 959.791

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality