Difference between revisions of "ILEUDEG-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
+== Pathway PWY-6634 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+** 3-sulfopropanediol degradation
-* smiles:
+== Reaction(s) found ==
-** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
+* [[RXN-11727]]
-* inchi-key:
+== Reaction(s) not found ==
-** pxypzmrmtkvysm-vxgbxaggsa-n
+* [NoneRXN-11729 RXN-11729]
-* molecular-weight:
+* [NoneRXN-11728 RXN-11728]
-** 266.253
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=3-sulfopropanediol degradation}}
-* [[RXN-15680]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
-{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
-{{#set: molecular-weight=266.253}}