Difference between revisions of "IMIDAZOLE ACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...") |
(Created page with "Category:metabolite == Metabolite IMIDAZOLE_ACETALDEHYDE == * common-name: ** imidazole acetaldehyde * smiles: ** c1(nc=nc(cc=o)=1) * inchi-key: ** mqsrgwnvezrldk-uhfffaoy...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IMIDAZOLE_ACETALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** imidazole acetaldehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc=nc(cc=o)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mqsrgwnvezrldk-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 110.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10089]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=imidazole acetaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mqsrgwnvezrldk-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=110.115}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite IMIDAZOLE_ACETALDEHYDE
- common-name:
- imidazole acetaldehyde
- smiles:
- c1(nc=nc(cc=o)=1)
- inchi-key:
- mqsrgwnvezrldk-uhfffaoysa-n
- molecular-weight:
- 110.115
