Difference between revisions of "IMINOASPARTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite CPD-236 == * common-name: ** gibberellin a29 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12902 ==
+
== Metabolite CPD-236 ==
 
* common-name:
 
* common-name:
** 5-methylhex-4-enoyl-coa
+
** gibberellin a29
 
* smiles:
 
* smiles:
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** beyylhumfmwplh-svhodsnwsa-j
+
** bkbyhsyzkiajda-lpemzmrwsa-m
 
* molecular-weight:
 
* molecular-weight:
** 873.658
+
** 347.387
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11917]]
+
* [[RXN-113]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylhex-4-enoyl-coa}}
+
{{#set: common-name=gibberellin a29}}
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
+
{{#set: inchi-key=inchikey=bkbyhsyzkiajda-lpemzmrwsa-m}}
{{#set: molecular-weight=873.658}}
+
{{#set: molecular-weight=347.387}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-236

  • common-name:
    • gibberellin a29
  • smiles:
    • c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
  • inchi-key:
    • bkbyhsyzkiajda-lpemzmrwsa-m
  • molecular-weight:
    • 347.387

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality