Difference between revisions of "INDOLE-3-GLYCEROL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT6 ACACT6] == * direction: ** reversible * common-name: ** lauroyl-coa:acetyl-coa c-acyltransfe...")
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCEROL-P == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT6 ACACT6] ==
+
== Metabolite INDOLE-3-GLYCEROL-P ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** lauroyl-coa:acetyl-coa c-acyltransferase
+
** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CO-A]][x] '''+''' 1.0 [[CPD-10284]][x] '''<=>''' 1.0 [[ACETYL-COA]][x] '''+''' 1.0 [[LAUROYLCOA-CPD]][x]
+
** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21818]]
+
** nqeqtypjsiephw-mnovxskesa-l
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 285.193
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN0-2381]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[TRYPSYN-RXN]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
{{#set: direction=reversible}}
+
* [[IGPSYN-RXN]]
−
{{#set: common-name=lauroyl-coa:acetyl-coa c-acyltransferase}}
+
* [[RXN0-2381]]
−
{{#set: nb gene associated=1}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: nb pathway associated=0}}
+
{{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular-weight=285.193}}
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite INDOLE-3-GLYCEROL-P

  • common-name:
    • (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
  • smiles:
    • c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
  • inchi-key:
    • nqeqtypjsiephw-mnovxskesa-l
  • molecular-weight:
    • 285.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=INDOLE-3-GLYCEROL-P&oldid=138686"