|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17019 RXN-17019] == | + | == Metabolite INDOLE-3-GLYCOL == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 1-acylglycerol-3-phosphate o-acyltransferase | + | ** indole-3-glycol |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.51 ec-2.3.1.51] | + | ** c2(=c(c1(c=cc=cc=1n2))c(o)co) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[CPD-10269]][c] '''+''' 1 [[CPD-18379]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-18380]][c]
| + | ** xnjdzrgywqbbmz-uhfffaoysa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 177.202 |
| − | * Gene: [[SJ10647]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN-5424]] |
| − | * Gene: [[SJ18009]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]] | + | {{#set: common-name=indole-3-glycol}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}} |
| − | * Gene: [[SJ13643]]
| + | {{#set: molecular-weight=177.202}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ20565]]
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ13801]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ01857]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ09888]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ15136]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ08831]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ13501]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=1-acylglycerol-3-phosphate o-acyltransferase}} | |
| − | {{#set: ec-number=ec-2.3.1.51}} | |
| − | {{#set: nb gene associated=10}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
