Difference between revisions of "INDOLE-3-GLYCOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-O-MeGuan-34-tRNAs == * common-name: ** a 2'-o-methylguanosine34 in trna == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)co) * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-O-MeGuan-34-tRNAs ==
+
== Metabolite INDOLE-3-GLYCOL ==
 
* common-name:
 
* common-name:
** a 2'-o-methylguanosine34 in trna
+
** indole-3-glycol
 +
* smiles:
 +
** c2(=c(c1(c=cc=cc=1n2))c(o)co)
 +
* inchi-key:
 +
** xnjdzrgywqbbmz-uhfffaoysa-n
 +
* molecular-weight:
 +
** 177.202
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11868]]
+
* [[RXN-5424]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2'-o-methylguanosine34 in trna}}
+
{{#set: common-name=indole-3-glycol}}
 +
{{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}}
 +
{{#set: molecular-weight=177.202}}

Latest revision as of 11:16, 18 March 2021

Metabolite INDOLE-3-GLYCOL

  • common-name:
    • indole-3-glycol
  • smiles:
    • c2(=c(c1(c=cc=cc=1n2))c(o)co)
  • inchi-key:
    • xnjdzrgywqbbmz-uhfffaoysa-n
  • molecular-weight:
    • 177.202

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality