Difference between revisions of "INDOLE-3-GLYCOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...") |
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)co) * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLE-3-GLYCOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** indole-3-glycol |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(=c(c1(c=cc=cc=1n2))c(o)co) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xnjdzrgywqbbmz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 177.202 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-5424]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indole-3-glycol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.202}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite INDOLE-3-GLYCOL
- common-name:
- indole-3-glycol
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(o)co)
- inchi-key:
- xnjdzrgywqbbmz-uhfffaoysa-n
- molecular-weight:
- 177.202
