Difference between revisions of "INDOLEYL-CPD"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19492 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GLYOXI-RXN ** Category...") |
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite INDOLEYL-CPD == |
− | + | * common-name: | |
− | * | + | ** (indole-3-yl)acetonitrile |
− | == | + | * smiles: |
− | * | + | ** c(#n)cc1(=cnc2(c=cc=cc1=2)) |
− | + | * inchi-key: | |
− | ** | + | ** dmcpfobljmlsnx-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | + | ** 156.187 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[RXN-1404]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=(indole-3-yl)acetonitrile}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=dmcpfobljmlsnx-uhfffaoysa-n}} |
− | {{#set: | + | {{#set: molecular-weight=156.187}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite INDOLEYL-CPD
- common-name:
- (indole-3-yl)acetonitrile
- smiles:
- c(#n)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- dmcpfobljmlsnx-uhfffaoysa-n
- molecular-weight:
- 156.187