|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ00855 == | + | == Metabolite INDOLEYL-CPD == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** (indole-3-yl)acetonitrile |
| − | * right-end-position: | + | * smiles: |
| − | ** 126983 | + | ** c(#n)cc1(=cnc2(c=cc=cc1=2)) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 84967 | + | ** dmcpfobljmlsnx-uhfffaoysa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 52.746033 | + | ** 156.187 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]] | + | * [[RXN-1404]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[3.2.1.21-RXN]]
| + | {{#set: common-name=(indole-3-yl)acetonitrile}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=dmcpfobljmlsnx-uhfffaoysa-n}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: molecular-weight=156.187}} |
| − | * [[7KAPSYN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[GLUCOSYLCERAMIDASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10769]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-10773]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-13600]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-13602]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-13603]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14179]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-5341]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-8036]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-9674]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated ==
| |
| − | * [[PWY-6578]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6788]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7089]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7091]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7092]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-3121]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5176]]
| |
| − | ** '''1''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6002]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=126983}} | |
| − | {{#set: left-end-position=84967}}
| |
| − | {{#set: centisome-position=52.746033 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=12}}
| |
| − | {{#set: nb pathway associated=8}}
| |
