Difference between revisions of "INDOLEYL-CPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-methylcytosine2278-in-25S-rRNA == * common-name: ** a 5-methylcytosine2278 in 25s rrna == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLEYL-CPD == |
* common-name: | * common-name: | ||
| − | ** | + | ** (indole-3-yl)acetonitrile |
| + | * smiles: | ||
| + | ** c(#n)cc1(=cnc2(c=cc=cc1=2)) | ||
| + | * inchi-key: | ||
| + | ** dmcpfobljmlsnx-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 156.187 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1404]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(indole-3-yl)acetonitrile}} |
| + | {{#set: inchi-key=inchikey=dmcpfobljmlsnx-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=156.187}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite INDOLEYL-CPD
- common-name:
- (indole-3-yl)acetonitrile
- smiles:
- c(#n)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- dmcpfobljmlsnx-uhfffaoysa-n
- molecular-weight:
- 156.187
