Difference between revisions of "INDOLE ACETATE AUXIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19914 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GCVT-RXN ** Category:...") |
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite INDOLE_ACETATE_AUXIN == |
| − | == | + | * common-name: |
| − | * | + | ** (indol-3-yl)acetate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) |
| − | ** | + | * inchi-key: |
| − | * | + | ** seovtrfcigrimh-uhfffaoysa-m |
| − | == | + | * molecular-weight: |
| − | + | ** 174.179 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-10711]] |
| − | {{#set: | + | * [[RXN-10715]] |
| + | * [[RXN-1404]] | ||
| + | * [[RXN-5581]] | ||
| + | * [[RXNDQC-2]] | ||
| + | * [[RXNN-404]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=(indol-3-yl)acetate}} | ||
| + | {{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=174.179}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite INDOLE_ACETATE_AUXIN
- common-name:
- (indol-3-yl)acetate
- smiles:
- c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- seovtrfcigrimh-uhfffaoysa-m
- molecular-weight:
- 174.179
