Difference between revisions of "INDOLE ACETATE AUXIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-356 == * common-name: ** d-arabinono-1,4-lactone * smiles: ** c(o)c1(oc(=o)c(o)c(o)1) * inchi-key: ** cuokhacjlgprhd-jjyyjpossa-n * m...") |
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLE_ACETATE_AUXIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** (indol-3-yl)acetate |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** seovtrfcigrimh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.179 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10711]] | ||
| + | * [[RXN-10715]] | ||
| + | * [[RXN-1404]] | ||
| + | * [[RXN-5581]] | ||
| + | * [[RXNDQC-2]] | ||
| + | * [[RXNN-404]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)acetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.179}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite INDOLE_ACETATE_AUXIN
- common-name:
- (indol-3-yl)acetate
- smiles:
- c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- seovtrfcigrimh-uhfffaoysa-m
- molecular-weight:
- 174.179
