Difference between revisions of "INDOLE ACETATE AUXIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19914 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GCVT-RXN ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-7107 == * common-name: ** deoxycohumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c * inchi-key: ** kkfizykk...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7107 == |
| − | == | + | * common-name: |
| − | + | ** deoxycohumulone | |
| − | = | + | * smiles: |
| − | * | + | ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c |
| − | ** | + | * inchi-key: |
| − | ** | + | ** kkfizykkqlwbkh-uhfffaoysa-m |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 331.431 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-7813]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| + | {{#set: common-name=deoxycohumulone}} | ||
| + | {{#set: inchi-key=inchikey=kkfizykkqlwbkh-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=331.431}} | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-7107
- common-name:
- deoxycohumulone
- smiles:
- cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c
- inchi-key:
- kkfizykkqlwbkh-uhfffaoysa-m
- molecular-weight:
- 331.431
