Difference between revisions of "INDOLE ACETATE AUXIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-356 == * common-name: ** d-arabinono-1,4-lactone * smiles: ** c(o)c1(oc(=o)c(o)c(o)1) * inchi-key: ** cuokhacjlgprhd-jjyyjpossa-n * m...") |
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * molecular-we...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-110 == |
* common-name: | * common-name: | ||
| − | ** | + | ** salicylate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c1(=cc=cc=c1o))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ygsdefsmjlzeoe-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 137.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[1 | + | * [[SALICYLATE-1-MONOOXYGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXNQT-4366]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=salicylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.115}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-110
- common-name:
- salicylate
- smiles:
- c(c1(=cc=cc=c1o))([o-])=o
- inchi-key:
- ygsdefsmjlzeoe-uhfffaoysa-m
- molecular-weight:
- 137.115
