Difference between revisions of "INDOLE PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08012 == * transcription-direction: ** positive * right-end-position: ** 23346 * left-end-position: ** 2755 * centisome-position: ** 4.6732144...")
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08012 ==
+
== Metabolite INDOLE_PYRUVATE ==
* transcription-direction:
+
* common-name:
** positive
+
** (indol-3-yl)pyruvate
* right-end-position:
+
* smiles:
** 23346
+
** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
* left-end-position:
+
* inchi-key:
** 2755
+
** rstklpzezygqpy-uhfffaoysa-m
* centisome-position:
+
* molecular-weight:
** 4.6732144   
+
** 202.189
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXNDQC-2]]
== Reaction(s) associated ==
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
* [[2.8.2.23-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) associated ==
+
{{#set: common-name=(indol-3-yl)pyruvate}}
* [[PWY-6558]]
+
{{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}}
** '''7''' reactions found over '''13''' reactions in the full pathway
+
{{#set: molecular-weight=202.189}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=23346}}
 
{{#set: left-end-position=2755}}
 
{{#set: centisome-position=4.6732144    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite INDOLE_PYRUVATE

  • common-name:
    • (indol-3-yl)pyruvate
  • smiles:
    • c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
  • inchi-key:
    • rstklpzezygqpy-uhfffaoysa-m
  • molecular-weight:
    • 202.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality