Difference between revisions of "INDOXYL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11521 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(sccnc(=o)ccn...") |
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOXYL == |
* common-name: | * common-name: | ||
| − | ** | + | ** indoxyl |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=cc1(=c(c(o)=cn1)c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pckpvgolpkluhr-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 133.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15587]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15587]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indoxyl}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pckpvgolpkluhr-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=133.149}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite INDOXYL
- common-name:
- indoxyl
- smiles:
- c2(c=cc1(=c(c(o)=cn1)c=2))
- inchi-key:
- pckpvgolpkluhr-uhfffaoysa-n
- molecular-weight:
- 133.149
