Difference between revisions of "INOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o...")
(Created page with "Category:metabolite == Metabolite CPD-712 == * common-name: ** 6-deoxocathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8890 ==
+
== Metabolite CPD-712 ==
 
* common-name:
 
* common-name:
** betanidin quinone
+
** 6-deoxocathasterone
 
* smiles:
 
* smiles:
** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** mcthlmsflmebek-aaeuagobsa-l
+
** zhzkwzjlunxosn-yuzbouazsa-n
 
* molecular-weight:
 
* molecular-weight:
** 384.301
+
** 418.702
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8635]]
+
* [[RXN-773]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=betanidin quinone}}
+
{{#set: common-name=6-deoxocathasterone}}
{{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}}
+
{{#set: inchi-key=inchikey=zhzkwzjlunxosn-yuzbouazsa-n}}
{{#set: molecular-weight=384.301}}
+
{{#set: molecular-weight=418.702}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-712

  • common-name:
    • 6-deoxocathasterone
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • zhzkwzjlunxosn-yuzbouazsa-n
  • molecular-weight:
    • 418.702

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality