Difference between revisions of "INOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-712 == * common-name: ** 6-deoxocathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))...") |
(Created page with "Category:metabolite == Metabolite CPD0-1718 == * common-name: ** 7,8-dihydropterin * smiles: ** c1(=nc2(=c(nc1)n=c(n)nc(=o)2)) * inchi-key: ** pxzwkvixskscfr-uhfffaoysa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1718 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydropterin |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=nc2(=c(nc1)n=c(n)nc(=o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pxzwkvixskscfr-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 165.154 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15261]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydropterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pxzwkvixskscfr-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=165.154}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD0-1718
- common-name:
- 7,8-dihydropterin
- smiles:
- c1(=nc2(=c(nc1)n=c(n)nc(=o)2))
- inchi-key:
- pxzwkvixskscfr-uhfffaoysa-n
- molecular-weight:
- 165.154
