Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03632 == * transcription-direction: ** negative * right-end-position: ** 616771 * left-end-position: ** 591488 * centisome-position: ** 57.957657...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03632 ==
+
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** d-myo-inositol (1,3,4)-trisphosphate
−
* right-end-position:
+
* smiles:
−
** 616771
+
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
−
* left-end-position:
+
* inchi-key:
−
** 591488
+
** mmwciqzxvozegg-mlqgymepsa-h
−
* centisome-position:
+
* molecular-weight:
−
** 57.957657   
+
** 414.049
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.1.133-RXN]]
−
== Reaction(s) associated ==
+
* [[2.7.1.139-RXN]]
−
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
+
* [[RXN-10939]]
−
** Category: [[annotation]]
+
* [[RXN-10959]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) associated ==
+
* [[RXN-8730]]
−
* [[PWY-6351]]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
−
* [[PWY-6352]]
+
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
−
** '''5''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=414.049}}
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=616771}}
 
−
{{#set: left-end-position=591488}}
 
−
{{#set: centisome-position=57.957657    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite INOSITOL-1-3-4-TRIPHOSPHATE

  • common-name:
    • d-myo-inositol (1,3,4)-trisphosphate
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • mmwciqzxvozegg-mlqgymepsa-h
  • molecular-weight:
    • 414.049

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=INOSITOL-1-3-4-TRIPHOSPHATE&oldid=138488"