Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=X5NT X5NT] == * direction: ** left-to-right * common-name: ** xmp-5'-nucleotidase == Reaction formu...")
 
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=X5NT X5NT] ==
+
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** xmp-5'-nucleotidase
+
** d-myo-inositol (1,3,4)-trisphosphate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[WATER]][c] '''+''' 1.0 [[XANTHOSINE-5-PHOSPHATE]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[XANTHOSINE]][c]
+
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ04587]]
+
** mmwciqzxvozegg-mlqgymepsa-h
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 414.049
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[2.7.1.133-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[2.7.1.139-RXN]]
−
== External links  ==
+
* [[RXN-10939]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-10959]]
−
{{#set: common-name=xmp-5'-nucleotidase}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: nb gene associated=1}}
+
* [[RXN-8730]]
−
{{#set: nb pathway associated=0}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction category=orthology}}
+
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
−
{{#set: reconstruction comment=n.a}}
+
{{#set: molecular-weight=414.049}}
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite INOSITOL-1-3-4-TRIPHOSPHATE

  • common-name:
    • d-myo-inositol (1,3,4)-trisphosphate
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • mmwciqzxvozegg-mlqgymepsa-h
  • molecular-weight:
    • 414.049

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=INOSITOL-1-3-4-TRIPHOSPHATE&oldid=138488"