Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-Phospho-RNA == * common-name: ** a 5'-phospho-ribonucleoside-[rna] == Reaction(s) known to consume the compound == * RNA-LIGASE-ATP-R...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-Phospho-RNA ==
+
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
 
* common-name:
 
* common-name:
** a 5'-phospho-ribonucleoside-[rna]
+
** d-myo-inositol (1,3,4)-trisphosphate
 +
* smiles:
 +
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 +
* inchi-key:
 +
** mmwciqzxvozegg-mlqgymepsa-h
 +
* molecular-weight:
 +
** 414.049
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RNA-LIGASE-ATP-RXN]]
+
* [[2.7.1.133-RXN]]
* [[RXN-17926]]
+
* [[2.7.1.139-RXN]]
 +
* [[RXN-10939]]
 +
* [[RXN-10959]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8730]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-phospho-ribonucleoside-[rna]}}
+
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
 +
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
 +
{{#set: molecular-weight=414.049}}

Latest revision as of 11:15, 18 March 2021

Metabolite INOSITOL-1-3-4-TRIPHOSPHATE

  • common-name:
    • d-myo-inositol (1,3,4)-trisphosphate
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • mmwciqzxvozegg-mlqgymepsa-h
  • molecular-weight:
    • 414.049

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality