Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03632 == * transcription-direction: ** negative * right-end-position: ** 616771 * left-end-position: ** 591488 * centisome-position: ** 57.957657...")
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03632 ==
+
== Metabolite CPD1F-131 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** antheraxanthin
−
* right-end-position:
+
* smiles:
−
** 616771
+
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
−
* left-end-position:
+
* inchi-key:
−
** 591488
+
** ofnsuwbaqrchav-oyquvcaxsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 57.957657   
+
** 584.881
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-7979]]
−
== Reaction(s) associated ==
+
* [[RXN-7985]]
−
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-7978]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7984]]
−
== Pathway(s) associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6351]]
+
{{#set: common-name=antheraxanthin}}
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
−
* [[PWY-6352]]
+
{{#set: molecular-weight=584.881}}
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=616771}}
 
−
{{#set: left-end-position=591488}}
 
−
{{#set: centisome-position=57.957657    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD1F-131

  • common-name:
    • antheraxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
  • inchi-key:
    • ofnsuwbaqrchav-oyquvcaxsa-n
  • molecular-weight:
    • 584.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=INOSITOL-1-3-4-TRIPHOSPHATE&oldid=47304"