Difference between revisions of "INOSITOL-1-4-5-TRISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7014 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7014 ==
+
== Metabolite INOSITOL-1-4-5-TRISPHOSPHATE ==
 +
* common-name:
 +
** d-myo-inositol (1,4,5)-trisphosphate
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
* common-name:
+
* inchi-key:
** chlorophyllide b
+
** mmwciqzxvozegg-xjtpdsdzsa-h
 
* molecular-weight:
 
* molecular-weight:
** 626.95
+
** 414.049
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7673]]
+
* [[2.7.1.127-RXN]]
* [[RXN-7674]]
+
* [[2.7.1.151-RXN]]
 +
* [[3.1.3.56-RXN]]
 +
* [[RXN-10948]]
 +
* [[RXN-13197]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13398]]
+
* [[3.1.4.11-RXN]]
* [[RXN-7673]]
+
* [[RXN-10948]]
 +
* [[RXN-13197]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chlorophyllide b}}
+
{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
{{#set: molecular-weight=626.95}}
+
{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
 +
{{#set: molecular-weight=414.049}}

Latest revision as of 11:13, 18 March 2021

Metabolite INOSITOL-1-4-5-TRISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4,5)-trisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mmwciqzxvozegg-xjtpdsdzsa-h
  • molecular-weight:
    • 414.049

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality