Difference between revisions of "INOSITOL-1-4-5-TRISPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04558 == * transcription-direction: ** negative * right-end-position: ** 14237 * left-end-position: ** 12563 * centisome-position: ** 11.895654...") |
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** d-myo-inositol (1,4,5)-trisphosphate |
− | + | * smiles: | |
− | + | ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1) | |
− | + | * inchi-key: | |
− | * | + | ** mmwciqzxvozegg-xjtpdsdzsa-h |
− | + | * molecular-weight: | |
− | ** | + | ** 414.049 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[2.7.1.127-RXN]] | |
− | = | + | * [[2.7.1.151-RXN]] |
− | + | * [[3.1.3.56-RXN]] | |
− | + | * [[RXN-10948]] | |
− | + | * [[RXN-13197]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[3.1.4.11-RXN]] |
− | + | * [[RXN-10948]] | |
− | ** | + | * [[RXN-13197]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}} | |
− | ** | + | {{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}} |
− | * [[ | + | {{#set: molecular-weight=414.049}} |
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite INOSITOL-1-4-5-TRISPHOSPHATE
- common-name:
- d-myo-inositol (1,4,5)-trisphosphate
- smiles:
- c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
- inchi-key:
- mmwciqzxvozegg-xjtpdsdzsa-h
- molecular-weight:
- 414.049