Difference between revisions of "INOSITOL-1-4-5-TRISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7014 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5...")
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7014 ==
+
== Metabolite PROTOPORPHYRINOGEN ==
 +
* common-name:
 +
** protoporphyrinogen ix
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
* common-name:
+
* inchi-key:
** chlorophyllide b
+
** uhsgpdmiqqynax-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 626.95
+
** 566.699
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7673]]
+
* [[PPPGO]]
* [[RXN-7674]]
+
* [[PROTOPORGENOXI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13398]]
+
* [[HEMN-RXN]]
* [[RXN-7673]]
+
* [[RXN0-1461]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chlorophyllide b}}
+
{{#set: common-name=protoporphyrinogen ix}}
{{#set: molecular-weight=626.95}}
+
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
 +
{{#set: molecular-weight=566.699}}

Revision as of 14:56, 5 January 2021

Metabolite PROTOPORPHYRINOGEN

  • common-name:
    • protoporphyrinogen ix
  • smiles:
    • c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
  • inchi-key:
    • uhsgpdmiqqynax-uhfffaoysa-l
  • molecular-weight:
    • 566.699

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality