Difference between revisions of "INOSITOL-1-4-5-TRISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16973 == * transcription-direction: ** negative * right-end-position: ** 265730 * left-end-position: ** 253872 * centisome-position: ** 92.22721...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16973 ==
+
== Metabolite INOSITOL-1-4-5-TRISPHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** d-myo-inositol (1,4,5)-trisphosphate
−
* right-end-position:
+
* smiles:
−
** 265730
+
** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 253872
+
** mmwciqzxvozegg-xjtpdsdzsa-h
−
* centisome-position:
+
* molecular-weight:
−
** 92.22721   
+
** 414.049
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.1.127-RXN]]
−
== Reaction(s) associated ==
+
* [[2.7.1.151-RXN]]
−
* [[3.4.23.15-RXN]]
+
* [[3.1.3.56-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10948]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13197]]
−
* [[3.4.23.5-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[3.1.4.11-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10948]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN-13197]]
−
{{#set: right-end-position=265730}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: left-end-position=253872}}
+
{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
−
{{#set: centisome-position=92.22721    }}
+
{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=414.049}}
−
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite INOSITOL-1-4-5-TRISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4,5)-trisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mmwciqzxvozegg-xjtpdsdzsa-h
  • molecular-weight:
    • 414.049

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=INOSITOL-1-4-5-TRISPHOSPHATE&oldid=137826"