Difference between revisions of "IS30-Insertion-Sequences"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7105 == * common-name: ** deoxyhumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c * inchi-key: ** nqybqbzoh...") |
(Created page with "Category:metabolite == Metabolite IS30-Insertion-Sequences == * common-name: ** an insertion sequence element is30 == Reaction(s) known to consume the compound == * RXN0...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite IS30-Insertion-Sequences == |
* common-name: | * common-name: | ||
− | ** | + | ** an insertion sequence element is30 |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-5131]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5131]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an insertion sequence element is30}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite IS30-Insertion-Sequences
- common-name:
- an insertion sequence element is30