Difference between revisions of "ISOBUTANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8613 == * common-name: ** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c...") |
(Created page with "Category:metabolite == Metabolite DEOXYGUANOSINE == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ykbgvtzy...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEOXYGUANOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2'-deoxyguanosine |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ykbgvtzyehremt-kvqbguixsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 267.244 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DEOXYGUANPHOSPHOR-RXN]] |
+ | * [[DMPH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DEOXYGUANPHOSPHOR-RXN]] | ||
+ | * [[DGTPTRIPHYDRO-RXN]] | ||
+ | * [[DMPH]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2'-deoxyguanosine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=267.244}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite DEOXYGUANOSINE
- common-name:
- 2'-deoxyguanosine
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ykbgvtzyehremt-kvqbguixsa-n
- molecular-weight:
- 267.244