Difference between revisions of "ISOBUTANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYGUANOSINE == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ykbgvtzy...") |
(Created page with "Category:metabolite == Metabolite Medium-Chain-234-Saturated-acyl-CoAs == * common-name: ** a medium-chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to consume t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Medium-Chain-234-Saturated-acyl-CoAs == |
* common-name: | * common-name: | ||
| − | ** 2 | + | ** a medium-chain 2,3,4-saturated fatty acyl coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11734]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11734]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2 | + | {{#set: common-name=a medium-chain 2,3,4-saturated fatty acyl coa}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite Medium-Chain-234-Saturated-acyl-CoAs
- common-name:
- a medium-chain 2,3,4-saturated fatty acyl coa
