Difference between revisions of "ISOCHORISMATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-Sialoglycoproteins == * common-name: ** a o-sialoglycoprotein == Reaction(s) known to consume the compound == * 3.4.24.57-RXN == Re...") |
(Created page with "Category:metabolite == Metabolite ISOCHORISMATE == * common-name: ** isochorismate * smiles: ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) * inchi-key: ** ntgwprccoqcmge-yumq...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ISOCHORISMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** isochorismate |
| + | * smiles: | ||
| + | ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** ntgwprccoqcmge-yumqzzprsa-l | ||
| + | * molecular-weight: | ||
| + | ** 224.17 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.5.1.64-RXN]] |
| + | * [[ISOCHORSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ISOCHORSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=isochorismate}} |
| + | {{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}} | ||
| + | {{#set: molecular-weight=224.17}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ISOCHORISMATE
- common-name:
- isochorismate
- smiles:
- c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)
- inchi-key:
- ntgwprccoqcmge-yumqzzprsa-l
- molecular-weight:
- 224.17
