Difference between revisions of "ISOPENICILLIN-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAMMA-BUTYROBETAINE == * common-name: ** γ-butyrobetaine * smiles: ** c[n+](cccc([o-])=o)(c)c * inchi-key: ** jhpnvniexxlntr-uhfffa...") |
(Created page with "Category:metabolite == Metabolite INOSINE == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** ugqmrvrmyyaskq-kqynxxcusa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite INOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** inosine |
* smiles: | * smiles: | ||
− | ** c | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ugqmrvrmyyaskq-kqynxxcusa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 268.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[INOPHOSPHOR-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ADENODEAMIN-RXN]] | ||
+ | * [[I5NT]] | ||
+ | * [[INOPHOSPHOR-RXN]] | ||
+ | * [[RXN-7607]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=inosine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ugqmrvrmyyaskq-kqynxxcusa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=268.229}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite INOSINE
- common-name:
- inosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- ugqmrvrmyyaskq-kqynxxcusa-n
- molecular-weight:
- 268.229