Difference between revisions of "ISOPENICILLIN-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...")
(Created page with "Category:metabolite == Metabolite CPD-15368 == * common-name: ** 3-oxo-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18312 ==
+
== Metabolite CPD-15368 ==
 
* common-name:
 
* common-name:
** n-3-fumaramoyl-l-2,3-diaminopropanoate
+
** 3-oxo-lesqueroloyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
+
** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** ujvdeptvvyupmx-qphdtyrisa-n
+
** nqxrrzbozbkgiu-mhaufedzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 201.182
+
** 1085.989
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16291]]
+
* [[RXN-14493]]
* [[RXN-16292]]
 
* [[RXN-16293]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14492]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}}
+
{{#set: common-name=3-oxo-lesqueroloyl-coa}}
{{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}}
+
{{#set: inchi-key=inchikey=nqxrrzbozbkgiu-mhaufedzsa-j}}
{{#set: molecular-weight=201.182}}
+
{{#set: molecular-weight=1085.989}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-15368

  • common-name:
    • 3-oxo-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nqxrrzbozbkgiu-mhaufedzsa-j
  • molecular-weight:
    • 1085.989

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality