Difference between revisions of "ISOPENICILLIN-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o...")
(Created page with "Category:metabolite == Metabolite ISOPENICILLIN-N == * common-name: ** isopenicillin n * smiles: ** cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-])) * in...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8890 ==
+
== Metabolite ISOPENICILLIN-N ==
 
* common-name:
 
* common-name:
** betanidin quinone
+
** isopenicillin n
 
* smiles:
 
* smiles:
** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
+
** cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-]))
 
* inchi-key:
 
* inchi-key:
** mcthlmsflmebek-aaeuagobsa-l
+
** mifyhuacuwqukt-gtqwgbsqsa-m
 
* molecular-weight:
 
* molecular-weight:
** 384.301
+
** 358.388
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8635]]
+
* [[1.21.3.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=betanidin quinone}}
+
{{#set: common-name=isopenicillin n}}
{{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}}
+
{{#set: inchi-key=inchikey=mifyhuacuwqukt-gtqwgbsqsa-m}}
{{#set: molecular-weight=384.301}}
+
{{#set: molecular-weight=358.388}}

Latest revision as of 11:14, 18 March 2021

Metabolite ISOPENICILLIN-N

  • common-name:
    • isopenicillin n
  • smiles:
    • cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-]))
  • inchi-key:
    • mifyhuacuwqukt-gtqwgbsqsa-m
  • molecular-weight:
    • 358.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality