Difference between revisions of "ISOPHENOXAZINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-uridines == * common-name: ** a uridine in trna == Reaction(s) known to consume the compound == * RXN0-1281 == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-uridines ==
+
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
 
* common-name:
 
* common-name:
** a uridine in trna
+
** 2,4-dinitrophenyl-s-glutathione
 +
* smiles:
 +
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
 +
* inchi-key:
 +
** fxeukvkgtkddiq-uwvggrqhsa-m
 +
* molecular-weight:
 +
** 472.406
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1281]]
+
* [[GST-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GST-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uridine in trna}}
+
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
 +
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
 +
{{#set: molecular-weight=472.406}}

Revision as of 18:58, 14 January 2021

Metabolite S-24-DINITROPHENYLGLUTATHIONE

  • common-name:
    • 2,4-dinitrophenyl-s-glutathione
  • smiles:
    • c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
  • inchi-key:
    • fxeukvkgtkddiq-uwvggrqhsa-m
  • molecular-weight:
    • 472.406

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality