|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.9-RXN 3.6.3.9-RXN] == | + | == Metabolite ISOPHENOXAZINE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** sodium:potassium-exchanging atpase | + | ** isophenoxazine |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.6.3.9 ec-3.6.3.9] | + | ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 2 [[K+]][e] '''+''' 3 [[NA+]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADP]][c] '''+''' 2 [[K+]][c] '''+''' 3 [[NA+]][e] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
| + | ** rdjxpxhqenrcng-uhfffaoysa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ05555]] | + | ** 212.207 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ09035]]
| + | * [[O-AMINOPHENOL-OXIDASE-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: common-name=isophenoxazine}} |
| − | * Gene: [[SJ08886]] | + | {{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=212.207}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18354 18354]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/O43134 O43134]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M3H6 Q7M3H6]
| |
| − | ** [http://www.uniprot.org/uniprot/P05023 P05023]
| |
| − | ** [http://www.uniprot.org/uniprot/P06685 P06685]
| |
| − | ** [http://www.uniprot.org/uniprot/P05027 P05027]
| |
| − | ** [http://www.uniprot.org/uniprot/P05028 P05028]
| |
| − | ** [http://www.uniprot.org/uniprot/P54707 P54707]
| |
| − | ** [http://www.uniprot.org/uniprot/P09572 P09572]
| |
| − | ** [http://www.uniprot.org/uniprot/P13638 P13638]
| |
| − | ** [http://www.uniprot.org/uniprot/P05029 P05029]
| |
| − | ** [http://www.uniprot.org/uniprot/P50993 P50993]
| |
| − | ** [http://www.uniprot.org/uniprot/P24797 P24797]
| |
| − | ** [http://www.uniprot.org/uniprot/P21188 P21188]
| |
| − | ** [http://www.uniprot.org/uniprot/Q64608 Q64608]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04680 Q04680]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PSP6 Q9PSP6]
| |
| − | ** [http://www.uniprot.org/uniprot/Q27766 Q27766]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PS52 Q9PS52]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PS72 Q9PS72]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92123 Q92123]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M3H7 Q7M3H7]
| |
| − | ** [http://www.uniprot.org/uniprot/P06686 P06686]
| |
| − | ** [http://www.uniprot.org/uniprot/P05024 P05024]
| |
| − | ** [http://www.uniprot.org/uniprot/P14415 P14415]
| |
| − | ** [http://www.uniprot.org/uniprot/P24798 P24798]
| |
| − | ** [http://www.uniprot.org/uniprot/P30715 P30715]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04679 Q04679]
| |
| − | ** [http://www.uniprot.org/uniprot/Q91580 Q91580]
| |
| − | ** [http://www.uniprot.org/uniprot/P06687 P06687]
| |
| − | ** [http://www.uniprot.org/uniprot/P20648 P20648]
| |
| − | ** [http://www.uniprot.org/uniprot/Q13818 Q13818]
| |
| − | ** [http://www.uniprot.org/uniprot/P30716 P30716]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04646 Q04646]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04645 Q04645]
| |
| − | ** [http://www.uniprot.org/uniprot/Q28887 Q28887]
| |
| − | ** [http://www.uniprot.org/uniprot/P28774 P28774]
| |
| − | ** [http://www.uniprot.org/uniprot/P25489 P25489]
| |
| − | ** [http://www.uniprot.org/uniprot/P06583 P06583]
| |
| − | ** [http://www.uniprot.org/uniprot/P05026 P05026]
| |
| − | ** [http://www.uniprot.org/uniprot/P07340 P07340]
| |
| − | ** [http://www.uniprot.org/uniprot/P04074 P04074]
| |
| − | ** [http://www.uniprot.org/uniprot/P05025 P05025]
| |
| − | ** [http://www.uniprot.org/uniprot/P13637 P13637]
| |
| − | ** [http://www.uniprot.org/uniprot/P13607 P13607]
| |
| − | ** [http://www.uniprot.org/uniprot/P18907 P18907]
| |
| − | ** [http://www.uniprot.org/uniprot/P17326 P17326]
| |
| − | ** [http://www.uniprot.org/uniprot/P14094 P14094]
| |
| − | ** [http://www.uniprot.org/uniprot/P30714 P30714]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M0G4 Q7M0G4]
| |
| − | ** [http://www.uniprot.org/uniprot/P51165 P51165]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92030 Q92030]
| |
| − | ** [http://www.uniprot.org/uniprot/O45240 O45240]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=sodium:potassium-exchanging atpase}} | |
| − | {{#set: ec-number=ec-3.6.3.9}} | |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
