Difference between revisions of "ISOPHENOXAZINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6952 RXN0-6952] == * direction: ** left-to-right * common-name: ** phosphatidylcholine 1-acylh...")
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6952 RXN0-6952] ==
+
== Metabolite ISOPHENOXAZINE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** phosphatidylcholine 1-acylhydrolase
+
** isophenoxazine
** phospholipase a1
+
* smiles:
* ec-number:
+
** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
** [http://enzyme.expasy.org/EC/3.1.1.32 ec-3.1.1.32]
+
* inchi-key:
== Reaction formula ==
+
** rdjxpxhqenrcng-uhfffaoysa-n
* 1 [[L-1-PHOSPHATIDYL-ETHANOLAMINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-ACYL-GPE]][c] '''+''' 1 [[Fatty-Acids]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 212.207
* Gene: [[SJ01382]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[O-AMINOPHENOL-OXIDASE-RXN]]
* Gene: [[SJ14819]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=isophenoxazine}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}}
* Gene: [[SJ02841]]
+
{{#set: molecular-weight=212.207}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ21874]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ22570]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=phosphatidylcholine 1-acylhydrolase|phospholipase a1}}
 
{{#set: ec-number=ec-3.1.1.32}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite ISOPHENOXAZINE

  • common-name:
    • isophenoxazine
  • smiles:
    • c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
  • inchi-key:
    • rdjxpxhqenrcng-uhfffaoysa-n
  • molecular-weight:
    • 212.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality