Difference between revisions of "ISOPHENOXAZINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8042 RXN-8042] == * direction: ** left-to-right * common-name: ** prolycopene isomerase * ec-nu...")
 
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8042 RXN-8042] ==
+
== Metabolite ISOPHENOXAZINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** prolycopene isomerase
+
** isophenoxazine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.2.1.13 ec-5.2.1.13]
+
** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-7496]][c] '''=>''' 1 [[CPD1F-114]][c]
+
** rdjxpxhqenrcng-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05083]]
+
** 212.207
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[O-AMINOPHENOL-OXIDASE-RXN]]
−
* [[PWY-6475]], trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
+
== Reaction(s) of unknown directionality ==
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
{{#set: common-name=isophenoxazine}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=212.207}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30974 30974]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07512 R07512]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=prolycopene isomerase}}
 
−
{{#set: ec-number=ec-5.2.1.13}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite ISOPHENOXAZINE

  • common-name:
    • isophenoxazine
  • smiles:
    • c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
  • inchi-key:
    • rdjxpxhqenrcng-uhfffaoysa-n
  • molecular-weight:
    • 212.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ISOPHENOXAZINE&oldid=139493"