Difference between revisions of "ISOPHENOXAZINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8042 RXN-8042] == * direction: ** left-to-right * common-name: ** prolycopene isomerase * ec-nu...") |
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ISOPHENOXAZINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** isophenoxazine |
− | * | + | * smiles: |
− | ** | + | ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) |
− | == | + | * inchi-key: |
− | + | ** rdjxpxhqenrcng-uhfffaoysa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 212.207 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[O-AMINOPHENOL-OXIDASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=isophenoxazine}} | |
− | + | {{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}} | |
− | * | + | {{#set: molecular-weight=212.207}} |
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite ISOPHENOXAZINE
- common-name:
- isophenoxazine
- smiles:
- c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
- inchi-key:
- rdjxpxhqenrcng-uhfffaoysa-n
- molecular-weight:
- 212.207