Difference between revisions of "ISOVALERYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05294 == * transcription-direction: ** positive * right-end-position: ** 232896 * left-end-position: ** 228989 * centisome-position: ** 46.05738...")
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * smiles: ** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05294 ==
+
== Metabolite ISOVALERYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** isovaleryl-coa
* right-end-position:
+
* smiles:
** 232896
+
** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
* left-end-position:
+
* inchi-key:
** 228989
+
** uyvziwwbjmyrcd-zmhdxicwsa-j
* centisome-position:
+
* molecular-weight:
** 46.05738   
+
** 847.62
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
== Reaction(s) associated ==
+
* [[IVCDH]]
* [[3.5.1.98-RXN]]
+
* [[RXN-14264]]
** Category: [[annotation]]
+
* [[RXN0-2301]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
{{#set: transcription-direction=positive}}
+
* [[RXN-14264]]
{{#set: right-end-position=232896}}
+
== Reaction(s) of unknown directionality ==
{{#set: left-end-position=228989}}
+
{{#set: common-name=isovaleryl-coa}}
{{#set: centisome-position=46.05738    }}
+
{{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=847.62}}
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite ISOVALERYL-COA

  • common-name:
    • isovaleryl-coa
  • smiles:
    • cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • uyvziwwbjmyrcd-zmhdxicwsa-j
  • molecular-weight:
    • 847.62

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality