Difference between revisions of "ITACONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite ITACONATE == * common-name: ** itaconate * smiles: ** c=c(c(=o)[o-])cc([o-])=o * inchi-key: ** lvhbhzanlowsrm-uhfffaoysa-l * molecular-we...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ITACONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** itaconate |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c(c(=o)[o-])cc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lvhbhzanlowsrm-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 128.084 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-8988]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=itaconate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lvhbhzanlowsrm-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=128.084}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ITACONATE
- common-name:
- itaconate
- smiles:
- c=c(c(=o)[o-])cc([o-])=o
- inchi-key:
- lvhbhzanlowsrm-uhfffaoysa-l
- molecular-weight:
- 128.084
