Difference between revisions of "ITACONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-methionine-S-S-oxides == * common-name: ** a protein-l-methionine-(s)-s-oxide == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite CPD-7105 == * common-name: ** deoxyhumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c * inchi-key: ** nqybqbzoh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7105 == |
* common-name: | * common-name: | ||
| − | ** | + | ** deoxyhumulone |
| + | * smiles: | ||
| + | ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c | ||
| + | * inchi-key: | ||
| + | ** nqybqbzohcaccr-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 345.458 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7810]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=deoxyhumulone}} |
| + | {{#set: inchi-key=inchikey=nqybqbzohcaccr-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=345.458}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-7105
- common-name:
- deoxyhumulone
- smiles:
- cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c
- inchi-key:
- nqybqbzohcaccr-uhfffaoysa-m
- molecular-weight:
- 345.458
