Difference between revisions of "ITP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c...")
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11409 ==
+
== Metabolite ITP ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate ether glucuronide
+
** itp
 
* smiles:
 
* smiles:
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
+
** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* inchi-key:
 
* inchi-key:
** gyorpzqlvmnogy-rupwjetcsa-l
+
** haejpqiatwhalx-kqynxxcusa-j
 
* molecular-weight:
 
* molecular-weight:
** 921.943
+
** 504.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ATP-DEAMINASE-RXN]]
 +
* [[ITCY]]
 +
* [[ITPP]]
 +
* [[ITUP]]
 +
* [[RXN-14120]]
 +
* [[RXN0-5073]]
 +
* [[RXN0-6382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10616]]
+
* [[ATID]]
 +
* [[ATIDm]]
 +
* [[ATP-DEAMINASE-RXN]]
 +
* [[RXN-14120]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: common-name=itp}}
{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}
+
{{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}}
{{#set: molecular-weight=921.943}}
+
{{#set: molecular-weight=504.137}}

Latest revision as of 11:11, 18 March 2021

Metabolite ITP

  • common-name:
    • itp
  • smiles:
    • c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • haejpqiatwhalx-kqynxxcusa-j
  • molecular-weight:
    • 504.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality