Difference between revisions of "ITP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glycerolipid-crepenynate == * common-name: ** a [glycerolipid]-crepenynate == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ITP == |
* common-name: | * common-name: | ||
− | ** | + | ** itp |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** haejpqiatwhalx-kqynxxcusa-j | ||
+ | * molecular-weight: | ||
+ | ** 504.137 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ATP-DEAMINASE-RXN]] | ||
+ | * [[ITCY]] | ||
+ | * [[ITPP]] | ||
+ | * [[ITUP]] | ||
+ | * [[RXN-14120]] | ||
+ | * [[RXN0-5073]] | ||
+ | * [[RXN0-6382]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ATID]] |
+ | * [[ATIDm]] | ||
+ | * [[ATP-DEAMINASE-RXN]] | ||
+ | * [[RXN-14120]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=itp}} |
+ | {{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}} | ||
+ | {{#set: molecular-weight=504.137}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ITP
- common-name:
- itp
- smiles:
- c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- haejpqiatwhalx-kqynxxcusa-j
- molecular-weight:
- 504.137