Difference between revisions of "ITP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7066 == * common-name: ** (2r,3s)-3-methylmalate * smiles: ** cc(c(=o)[o-])c(o)c([o-])=o * inchi-key: ** npyqjihhtgfbln-sthayslisa-l...") |
(Created page with "Category:metabolite == Metabolite Glycerolipid-crepenynate == * common-name: ** a [glycerolipid]-crepenynate == Reaction(s) known to consume the compound == == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glycerolipid-crepenynate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-crepenynate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.14.99.33-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-crepenynate}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite Glycerolipid-crepenynate
- common-name:
- a [glycerolipid]-crepenynate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-crepenynate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
