Difference between revisions of "K-HEXANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCHL HBCHL] == * direction: ** reversible * common-name: ** 3-hydroxybutanoyl-coa hydro-lyase == R...")
(Created page with "Category:metabolite == Metabolite K-HEXANOYL-COA == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCHL HBCHL] ==
+
== Metabolite K-HEXANOYL-COA ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 3-hydroxybutanoyl-coa hydro-lyase
+
** 3-oxohexanoyl-coa
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[S-3-HYDROXYBUTANOYL-COA]][c] '''<=>''' 1.0 [[CROTONYL-COA]][c] '''+''' 1.0 [[WATER]][c]
+
** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21390]]
+
** nfoyyxqavvywkv-hdrqghtbsa-j
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 875.63
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[HACD2h]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12570]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
{{#set: direction=reversible}}
+
* [[ACACT2h]]
−
{{#set: common-name=3-hydroxybutanoyl-coa hydro-lyase}}
+
* [[HACD2h]]
−
{{#set: nb gene associated=1}}
+
* [[RXN-12565]]
−
{{#set: nb pathway associated=0}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction category=orthology}}
+
{{#set: common-name=3-oxohexanoyl-coa}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
−
{{#set: reconstruction comment=n.a}}
+
{{#set: molecular-weight=875.63}}
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite K-HEXANOYL-COA

  • common-name:
    • 3-oxohexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
  • inchi-key:
    • nfoyyxqavvywkv-hdrqghtbsa-j
  • molecular-weight:
    • 875.63

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=K-HEXANOYL-COA&oldid=139564"