Difference between revisions of "K-HEXANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] == * direction: ** left-to-right * common-name: ** 4α-carboxy-4β-me...")
 
(Created page with "Category:metabolite == Metabolite K-HEXANOYL-COA == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] ==
+
== Metabolite K-HEXANOYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol 3-dehydrogenase (decarboxylating)
+
** 3-oxohexanoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.170 ec-1.1.1.170]
+
** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-4577]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-4578]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
+
** nfoyyxqavvywkv-hdrqghtbsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04782]]
+
** 875.63
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[HACD2h]]
−
== Pathway(s) ==
+
* [[RXN-12570]]
−
* [[PWY-6074]], zymosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074]
+
== Reaction(s) known to produce the compound ==
−
** '''6''' reactions found over '''14''' reactions in the full pathway
+
* [[ACACT2h]]
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
* [[HACD2h]]
−
** '''14''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-12565]]
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
== Reaction(s) of unknown directionality ==
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
{{#set: common-name=3-oxohexanoyl-coa}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=875.63}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33448 33448]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07494 R07494]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol 3-dehydrogenase (decarboxylating)}}
 
−
{{#set: ec-number=ec-1.1.1.170}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite K-HEXANOYL-COA

  • common-name:
    • 3-oxohexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
  • inchi-key:
    • nfoyyxqavvywkv-hdrqghtbsa-j
  • molecular-weight:
    • 875.63

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=K-HEXANOYL-COA&oldid=139564"