Difference between revisions of "Keratan-sulfate-NAcGlc"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCOLALDEHYDE == * common-name: ** glycolaldehyde * smiles: ** c(o)[ch]=o * inchi-key: ** wgcnasohlspbmp-uhfffaoysa-n * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite CPD-12673 == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c(o)c(o)c(o)ccl * inchi-key: ** ijqsocfskcenow-bxxzvta...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12673 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-chloro-5-deoxy-d-ribonate |
* smiles: | * smiles: | ||
| − | ** c(o)[ | + | ** c(=o)([o-])c(o)c(o)c(o)ccl |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ijqsocfskcenow-bxxzvtaosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 183.568 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11717]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-chloro-5-deoxy-d-ribonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.568}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-12673
- common-name:
- 5-chloro-5-deoxy-d-ribonate
- smiles:
- c(=o)([o-])c(o)c(o)c(o)ccl
- inchi-key:
- ijqsocfskcenow-bxxzvtaosa-m
- molecular-weight:
- 183.568
