Difference between revisions of "Keratan-sulfate-NAcGlcN6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15662 == * common-name: ** (3r)-hydroxy, 4-trans-undecenoyl-coa * smiles: ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite ETF-Oxidized == * common-name: ** an oxidized electron-transfer flavoprotein == Reaction(s) known to consume the compound == * 1.5.5.1-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15662 ==
+
== Metabolite ETF-Oxidized ==
 
* common-name:
 
* common-name:
−
** (3r)-hydroxy, 4-trans-undecenoyl-coa
+
** an oxidized electron-transfer flavoprotein
−
* smiles:
 
−
** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
−
* inchi-key:
 
−
** anvriwfxmmcuph-qyzxfxbmsa-j
 
−
* molecular-weight:
 
−
** 945.764
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.5.5.1-RXN]]
 +
* [[ACYLCOADEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11734]]
 +
* [[RXN-13449]]
 +
* [[RXN-13615]]
 +
* [[RXN-14229]]
 +
* [[RXN-14262]]
 +
* [[RXN-14278]]
 +
* [[RXN-17775]]
 +
* [[RXN-17779]]
 +
* [[RXN-17783]]
 +
* [[RXN-17784]]
 +
* [[RXN-17788]]
 +
* [[RXN-17792]]
 +
* [[RXN-17796]]
 +
* [[RXN0-2301]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14791]]
+
* [[1.5.5.1-RXN]]
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11734]]
 +
* [[RXN-14229]]
 +
* [[RXN-14262]]
 +
* [[RXN-14278]]
 +
* [[RXN66-550]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3r)-hydroxy, 4-trans-undecenoyl-coa}}
+
{{#set: common-name=an oxidized electron-transfer flavoprotein}}
−
{{#set: inchi-key=inchikey=anvriwfxmmcuph-qyzxfxbmsa-j}}
 
−
{{#set: molecular-weight=945.764}}
 

Revision as of 11:15, 15 January 2021

Metabolite ETF-Oxidized

  • common-name:
    • an oxidized electron-transfer flavoprotein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Keratan-sulfate-NAcGlcN6S&oldid=111644"