Difference between revisions of "Keratan-sulfate-NAcGlcN6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ETF-Oxidized == * common-name: ** an oxidized electron-transfer flavoprotein == Reaction(s) known to consume the compound == * 1.5.5.1-...")
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ETF-Oxidized ==
+
== Metabolite CPD-14407 ==
 
* common-name:
 
* common-name:
** an oxidized electron-transfer flavoprotein
+
** dihomo γ-linolenoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** fjwjalrunnzibb-ddquopdjsa-j
 +
* molecular-weight:
 +
** 1051.975
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.5.1-RXN]]
+
* [[RXN-13435]]
* [[ACYLCOADEHYDROG-RXN]]
+
* [[RXN-16044]]
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-11734]]
 
* [[RXN-13449]]
 
* [[RXN-13615]]
 
* [[RXN-14229]]
 
* [[RXN-14262]]
 
* [[RXN-14278]]
 
* [[RXN-17775]]
 
* [[RXN-17779]]
 
* [[RXN-17783]]
 
* [[RXN-17784]]
 
* [[RXN-17788]]
 
* [[RXN-17792]]
 
* [[RXN-17796]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.5.5.1-RXN]]
+
* [[RXN-12971]]
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[RXN-17105]]
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-11734]]
 
* [[RXN-14229]]
 
* [[RXN-14262]]
 
* [[RXN-14278]]
 
* [[RXN66-550]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized electron-transfer flavoprotein}}
+
{{#set: common-name=dihomo γ-linolenoyl-coa}}
 +
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
 +
{{#set: molecular-weight=1051.975}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-14407

  • common-name:
    • dihomo γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fjwjalrunnzibb-ddquopdjsa-j
  • molecular-weight:
    • 1051.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality