Difference between revisions of "Keratan-sulfate-NAcGlcN6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlcN6S == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consu...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14407 ==
+
== Metabolite Keratan-sulfate-NAcGlcN6S ==
 
* common-name:
 
* common-name:
** dihomo γ-linolenoyl-coa
+
** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
* smiles:
 
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** fjwjalrunnzibb-ddquopdjsa-j
 
* molecular-weight:
 
** 1051.975
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13435]]
+
* [[RXN-11570]]
* [[RXN-16044]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12971]]
 
* [[RXN-17105]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}}
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
 
{{#set: molecular-weight=1051.975}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Keratan-sulfate-NAcGlcN6S

  • common-name:
    • [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.